C13H18O2S — CID 106496640
(1R)-1-[2-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol (PubChem CID 106496640) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (1R)-1-[2-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol.
| Compound Name | (1R)-1-[2-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 106496640 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1R)-1-[2-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C13H18O2S/c1-10(14)12-6-2-3-7-13(12)16-9-11-5-4-8-15-11/h2-3,6-7,10-11,14H,4-5,8-9H2,1H3/t10-,11?/m1/s1 |
| InChIKey | WPLIDUTVXQFVBW-NFJWQWPMSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |