C13H17NO3S — CID 106495160
methyl 2-amino-3-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 106495160) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-amino-3-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | methyl 2-amino-3-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 106495160 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl 2-amino-3-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | COC(=O)c1cccc(SCC2CCCO2)c1N |
| InChI | InChI=1S/C13H17NO3S/c1-16-13(15)10-5-2-6-11(12(10)14)18-8-9-4-3-7-17-9/h2,5-6,9H,3-4,7-8,14H2,1H3 |
| InChIKey | RUUGXARGSZFWKT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|