C21H23NO4S — CID 8733083
[2-(N-methylanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733083) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733083 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1SC[C@@H]1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO4S/c1-22(16-8-3-2-4-9-16)20(23)14-26-21(24)18-11-5-6-12-19(18)27-15-17-10-7-13-25-17/h2-6,8-9,11-12,17H,7,10,13-15H2,1H3/t17-/m0/s1 |
| InChIKey | YKBCSFSXCHENAB-KRWDZBQOSA-N |
| XLogP | 3.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |