C22H24FNO4S — CID 55405573
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55405573) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55405573 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C22H24FNO4S/c1-24(13-16-7-2-4-10-19(16)23)21(25)14-28-22(26)18-9-3-5-11-20(18)29-15-17-8-6-12-27-17/h2-5,7,9-11,17H,6,8,12-15H2,1H3 |
| InChIKey | CPJKNAJQZLHYDO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |