C21H21NO6S — CID 8733478
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733478) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733478 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2SC[C@@H]2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21NO6S/c1-14-8-9-15(11-18(14)22(25)26)19(23)12-28-21(24)17-6-2-3-7-20(17)29-13-16-5-4-10-27-16/h2-3,6-9,11,16H,4-5,10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | FNDYSZZRYGSVLC-INIZCTEOSA-N |
| XLogP | 4.21 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|