C13H17NO4S — CID 106496669
(1S)-1-[3-nitro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol (PubChem CID 106496669) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is (1S)-1-[3-nitro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol.
| Compound Name | (1S)-1-[3-nitro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 106496669 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (1S)-1-[3-nitro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(SCC2CCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17NO4S/c1-9(15)10-4-5-13(12(7-10)14(16)17)19-8-11-3-2-6-18-11/h4-5,7,9,11,15H,2-3,6,8H2,1H3/t9-,11?/m0/s1 |
| InChIKey | PFHQCJGWAWLOQX-FTNKSUMCSA-N |
| XLogP | 2.92 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|