C21H23N3O7S — CID 46371179
N'-(3,5-dimethoxybenzoyl)-3-nitro-4-(oxolan-2-ylmethylsulfanyl)benzohydrazide (PubChem CID 46371179) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is N'-(3,5-dimethoxybenzoyl)-3-nitro-4-(oxolan-2-ylmethylsulfanyl)benzohydrazide.
| Compound Name | N'-(3,5-dimethoxybenzoyl)-3-nitro-4-(oxolan-2-ylmethylsulfanyl)benzohydrazide |
|---|---|
| PubChem CID | 46371179 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N'-(3,5-dimethoxybenzoyl)-3-nitro-4-(oxolan-2-ylmethylsulfanyl)benzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)c2ccc(SCC3CCCO3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H23N3O7S/c1-29-16-8-14(9-17(11-16)30-2)21(26)23-22-20(25)13-5-6-19(18(10-13)24(27)28)32-12-15-4-3-7-31-15/h5-6,8-11,15H,3-4,7,12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | DGHGBKRYAGGAJA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|