C13H16N2O4S — CID 17395490
4-methylsulfanyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17395490) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-methylsulfanyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-methylsulfanyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17395490 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-methylsulfanyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CSc1ccc(C(=O)NCC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O4S/c1-20-12-5-4-9(7-11(12)15(17)18)13(16)14-8-10-3-2-6-19-10/h4-5,7,10H,2-3,6,8H2,1H3,(H,14,16) |
| InChIKey | GKGXQYYMMNWGBW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|