C12H13FN2O4 — CID 55103551
3-fluoro-4-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55103551) has the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 3-fluoro-4-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-fluoro-4-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55103551 |
| Molecular Formula | C12H13FN2O4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-fluoro-4-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C12H13FN2O4/c13-10-6-8(3-4-11(10)15(17)18)12(16)14-7-9-2-1-5-19-9/h3-4,6,9H,1-2,5,7H2,(H,14,16) |
| InChIKey | CBXBTEOUZHGGQC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|