C13H15ClO2S — CID 106494659
1-[2-chloro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanone (PubChem CID 106494659) has the molecular formula C13H15ClO2S and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-[2-chloro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanone.
| Compound Name | 1-[2-chloro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanone |
|---|---|
| PubChem CID | 106494659 |
| Molecular Formula | C13H15ClO2S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-[2-chloro-4-(oxolan-2-ylmethylsulfanyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(SCC2CCCO2)cc1Cl |
| InChI | InChI=1S/C13H15ClO2S/c1-9(15)12-5-4-11(7-13(12)14)17-8-10-3-2-6-16-10/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | GLALYNZVBCJKEK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |