C21H16N2OS — CID 27162221
4,5-diphenyl-2-(pyridin-4-ylmethylsulfanyl)-1,3-oxazole (PubChem CID 27162221) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 4,5-diphenyl-2-(pyridin-4-ylmethylsulfanyl)-1,3-oxazole.
| Compound Name | 4,5-diphenyl-2-(pyridin-4-ylmethylsulfanyl)-1,3-oxazole |
|---|---|
| PubChem CID | 27162221 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4,5-diphenyl-2-(pyridin-4-ylmethylsulfanyl)-1,3-oxazole |
| SMILES | c1ccc(-c2nc(SCc3ccncc3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16N2OS/c1-3-7-17(8-4-1)19-20(18-9-5-2-6-10-18)24-21(23-19)25-15-16-11-13-22-14-12-16/h1-14H,15H2 |
| InChIKey | NNPQGVXERCCLIK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |