C17H12ClNO2S — CID 54148093
2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetyl chloride (PubChem CID 54148093) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetyl chloride.
| Compound Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetyl chloride |
|---|---|
| PubChem CID | 54148093 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetyl chloride |
| SMILES | O=C(Cl)CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H12ClNO2S/c18-14(20)11-22-17-19-15(12-7-3-1-4-8-12)16(21-17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | OFUIVVTVIZOBNR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|