C25H21N3O3S — CID 2453469
N-(benzylcarbamoyl)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide (PubChem CID 2453469) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2453469 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)o1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H21N3O3S/c29-21(27-24(30)26-16-18-10-4-1-5-11-18)17-32-25-28-22(19-12-6-2-7-13-19)23(31-25)20-14-8-3-9-15-20/h1-15H,16-17H2,(H2,26,27,29,30) |
| InChIKey | YPYCDLOBZACGCC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |