C19H17NO3S — CID 54003454
2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-2-methylpropanoic acid (PubChem CID 54003454) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54003454 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1nc(-c2ccccc2)c(-c2ccccc2)o1)C(=O)O |
| InChI | InChI=1S/C19H17NO3S/c1-19(2,17(21)22)24-18-20-15(13-9-5-3-6-10-13)16(23-18)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,21,22) |
| InChIKey | KNFQCUZHMHNXJB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |