C20H17NO4S — CID 142239112
2-[4-(4-formyl-5-phenyl-1,3-oxazol-2-yl)phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 142239112) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[4-(4-formyl-5-phenyl-1,3-oxazol-2-yl)phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-(4-formyl-5-phenyl-1,3-oxazol-2-yl)phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142239112 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[4-(4-formyl-5-phenyl-1,3-oxazol-2-yl)phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1ccc(-c2nc(C=O)c(-c3ccccc3)o2)cc1)C(=O)O |
| InChI | InChI=1S/C20H17NO4S/c1-20(2,19(23)24)26-15-10-8-14(9-11-15)18-21-16(12-22)17(25-18)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,23,24) |
| InChIKey | HRHNIOFVHJASQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|