C32H28N2O3 — CID 10435598
methyl 2-[3-[2-(3,4,5-triphenylpyrazol-1-yl)ethyl]phenoxy]acetate (PubChem CID 10435598) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is methyl 2-[3-[2-(3,4,5-triphenylpyrazol-1-yl)ethyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[2-(3,4,5-triphenylpyrazol-1-yl)ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 10435598 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | methyl 2-[3-[2-(3,4,5-triphenylpyrazol-1-yl)ethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(CCn2nc(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C32H28N2O3/c1-36-29(35)23-37-28-19-11-12-24(22-28)20-21-34-32(27-17-9-4-10-18-27)30(25-13-5-2-6-14-25)31(33-34)26-15-7-3-8-16-26/h2-19,22H,20-21,23H2,1H3 |
| InChIKey | VVAQLCPYTBRJSH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |