C25H21N3O4 — CID 10094040
2-[3-[2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)ethyl]phenoxy]acetic acid (PubChem CID 10094040) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[3-[2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)ethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10094040 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[3-[2-(3-oxo-5,6-diphenyl-1,2,4-triazin-2-yl)ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CCn2nc(-c3ccccc3)c(-c3ccccc3)nc2=O)c1 |
| InChI | InChI=1S/C25H21N3O4/c29-22(30)17-32-21-13-7-8-18(16-21)14-15-28-25(31)26-23(19-9-3-1-4-10-19)24(27-28)20-11-5-2-6-12-20/h1-13,16H,14-15,17H2,(H,29,30) |
| InChIKey | GPURFBUGAZAPOV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |