C21H20N2O5 — CID 174769868
3-[2-[3-[3-(2-hydroxyethoxy)phenyl]-6-oxopyridazin-1-yl]ethyl]benzoic acid (PubChem CID 174769868) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[2-[3-[3-(2-hydroxyethoxy)phenyl]-6-oxopyridazin-1-yl]ethyl]benzoic acid.
| Compound Name | 3-[2-[3-[3-(2-hydroxyethoxy)phenyl]-6-oxopyridazin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174769868 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-[2-[3-[3-(2-hydroxyethoxy)phenyl]-6-oxopyridazin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCn2nc(-c3cccc(OCCO)c3)ccc2=O)c1 |
| InChI | InChI=1S/C21H20N2O5/c24-11-12-28-18-6-2-4-16(14-18)19-7-8-20(25)23(22-19)10-9-15-3-1-5-17(13-15)21(26)27/h1-8,13-14,24H,9-12H2,(H,26,27) |
| InChIKey | GMHZVDCUEQPSAD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |