C29H30N2O4S — CID 54196470
methyl 2-[5-(3,4,5-triphenylpyrazol-1-yl)pentylsulfonyl]acetate (PubChem CID 54196470) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is methyl 2-[5-(3,4,5-triphenylpyrazol-1-yl)pentylsulfonyl]acetate.
| Compound Name | methyl 2-[5-(3,4,5-triphenylpyrazol-1-yl)pentylsulfonyl]acetate |
|---|---|
| PubChem CID | 54196470 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | methyl 2-[5-(3,4,5-triphenylpyrazol-1-yl)pentylsulfonyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)CCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H30N2O4S/c1-35-26(32)22-36(33,34)21-13-5-12-20-31-29(25-18-10-4-11-19-25)27(23-14-6-2-7-15-23)28(30-31)24-16-8-3-9-17-24/h2-4,6-11,14-19H,5,12-13,20-22H2,1H3 |
| InChIKey | PMDSPOARUQMAOU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|