C30H32N2O2S — CID 15725742
methyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexylsulfanyl]acetate (PubChem CID 15725742) has the molecular formula C30H32N2O2S and a molecular weight of 484.67 g/mol. Its IUPAC name is methyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexylsulfanyl]acetate.
| Compound Name | methyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexylsulfanyl]acetate |
|---|---|
| PubChem CID | 15725742 |
| Molecular Formula | C30H32N2O2S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | methyl 2-[6-(3,4,5-triphenylpyrazol-1-yl)hexylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H32N2O2S/c1-34-27(33)23-35-22-14-3-2-13-21-32-30(26-19-11-6-12-20-26)28(24-15-7-4-8-16-24)29(31-32)25-17-9-5-10-18-25/h4-12,15-20H,2-3,13-14,21-23H2,1H3 |
| InChIKey | CQXYKMVUJYBZSH-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|