C23H25N3O4S — CID 66782900
1-(3-methoxy-3-oxopropyl)-4-(4-phenyl-N-sulfinoanilino)-4,5,6,7-tetrahydroindazole (PubChem CID 66782900) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-(3-methoxy-3-oxopropyl)-4-(4-phenyl-N-sulfinoanilino)-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(3-methoxy-3-oxopropyl)-4-(4-phenyl-N-sulfinoanilino)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 66782900 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-(3-methoxy-3-oxopropyl)-4-(4-phenyl-N-sulfinoanilino)-4,5,6,7-tetrahydroindazole |
| SMILES | COC(=O)CCn1ncc2c1CCCC2N(c1ccc(-c2ccccc2)cc1)S(=O)O |
| InChI | InChI=1S/C23H25N3O4S/c1-30-23(27)14-15-25-21-8-5-9-22(20(21)16-24-25)26(31(28)29)19-12-10-18(11-13-19)17-6-3-2-4-7-17/h2-4,6-7,10-13,16,22H,5,8-9,14-15H2,1H3,(H,28,29) |
| InChIKey | AQRPJBFJHUKYJN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|