C23H21F3N3O4S- — CID 77189631
1-(2-carboxyethyl)-4-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-4,5,6,7-tetrahydroindazole (PubChem CID 77189631) has the molecular formula C23H21F3N3O4S- and a molecular weight of 492.50 g/mol. Its IUPAC name is 1-(2-carboxyethyl)-4-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(2-carboxyethyl)-4-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 77189631 |
| Molecular Formula | C23H21F3N3O4S- |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-(2-carboxyethyl)-4-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-4,5,6,7-tetrahydroindazole |
| SMILES | O=C(O)CCn1ncc2c1CCCC2N(c1ccc(-c2cccc(C(F)(F)F)c2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C23H22F3N3O4S/c24-23(25,26)17-4-1-3-16(13-17)15-7-9-18(10-8-15)29(34(32)33)21-6-2-5-20-19(21)14-27-28(20)12-11-22(30)31/h1,3-4,7-10,13-14,21H,2,5-6,11-12H2,(H,30,31)(H,32,33)/p-1 |
| InChIKey | FVVICNHGHKUOKN-UHFFFAOYSA-M |
| XLogP | 4.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|