C21H19FN3O4S- — CID 66782802
1-(carboxymethyl)-4-[4-(4-fluorophenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole (PubChem CID 66782802) has the molecular formula C21H19FN3O4S- and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-(carboxymethyl)-4-[4-(4-fluorophenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(carboxymethyl)-4-[4-(4-fluorophenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 66782802 |
| Molecular Formula | C21H19FN3O4S- |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 1-(carboxymethyl)-4-[4-(4-fluorophenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole |
| SMILES | O=C(O)Cn1ncc2c1CCCC2N(c1ccc(-c2ccc(F)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C21H20FN3O4S/c22-16-8-4-14(5-9-16)15-6-10-17(11-7-15)25(30(28)29)20-3-1-2-19-18(20)12-23-24(19)13-21(26)27/h4-12,20H,1-3,13H2,(H,26,27)(H,28,29)/p-1 |
| InChIKey | OWQSJISFQFUSPJ-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|