C26H30N3O5S- — CID 90998054
1-(2-ethoxy-2-oxoethyl)-4-[4-(3-propan-2-yloxyphenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole (PubChem CID 90998054) has the molecular formula C26H30N3O5S- and a molecular weight of 496.61 g/mol. Its IUPAC name is 1-(2-ethoxy-2-oxoethyl)-4-[4-(3-propan-2-yloxyphenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(2-ethoxy-2-oxoethyl)-4-[4-(3-propan-2-yloxyphenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 90998054 |
| Molecular Formula | C26H30N3O5S- |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1-(2-ethoxy-2-oxoethyl)-4-[4-(3-propan-2-yloxyphenyl)-N-sulfinatoanilino]-4,5,6,7-tetrahydroindazole |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2N(c1ccc(-c2cccc(OC(C)C)c2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C26H31N3O5S/c1-4-33-26(30)17-28-24-9-6-10-25(23(24)16-27-28)29(35(31)32)21-13-11-19(12-14-21)20-7-5-8-22(15-20)34-18(2)3/h5,7-8,11-16,18,25H,4,6,9-10,17H2,1-3H3,(H,31,32)/p-1 |
| InChIKey | OLOBHECQOKIAPD-UHFFFAOYSA-M |
| XLogP | 4.58 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|