C26H33N3O4SSi — CID 59152981
ethyl 2-[(4R)-4-[[4-(3-trimethylsilylphenyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate (PubChem CID 59152981) has the molecular formula C26H33N3O4SSi and a molecular weight of 511.72 g/mol. Its IUPAC name is ethyl 2-[(4R)-4-[[4-(3-trimethylsilylphenyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate.
| Compound Name | ethyl 2-[(4R)-4-[[4-(3-trimethylsilylphenyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
|---|---|
| PubChem CID | 59152981 |
| Molecular Formula | C26H33N3O4SSi |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | ethyl 2-[(4R)-4-[[4-(3-trimethylsilylphenyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc2c1CCC[C@H]2NS(=O)(=O)c1ccc(-c2cccc([Si](C)(C)C)c2)cc1 |
| InChI | InChI=1S/C26H33N3O4SSi/c1-5-33-26(30)18-29-25-11-7-10-24(23(25)17-27-29)28-34(31,32)21-14-12-19(13-15-21)20-8-6-9-22(16-20)35(2,3)4/h6,8-9,12-17,24,28H,5,7,10-11,18H2,1-4H3/t24-/m1/s1 |
| InChIKey | RURMZBZITCCLAF-XMMPIXPASA-N |
| XLogP | 4.01 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|