C17H22N4O5S — CID 87693683
ethyl 2-[4-[[3-(hydroxyamino)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate (PubChem CID 87693683) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(hydroxyamino)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[3-(hydroxyamino)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
|---|---|
| PubChem CID | 87693683 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | ethyl 2-[4-[[3-(hydroxyamino)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2NS(=O)(=O)c1cccc(NO)c1 |
| InChI | InChI=1S/C17H22N4O5S/c1-2-26-17(22)11-21-16-8-4-7-15(14(16)10-18-21)20-27(24,25)13-6-3-5-12(9-13)19-23/h3,5-6,9-10,15,19-20,23H,2,4,7-8,11H2,1H3 |
| InChIKey | KBZHLXJBJGLSTF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|