C18H19BF3N3O4S — CID 89105285
CID 89105285 (PubChem CID 89105285) has the molecular formula C18H19BF3N3O4S and a molecular weight of 441.24 g/mol.
| Compound Name | CID 89105285 |
|---|---|
| PubChem CID | 89105285 |
| Molecular Formula | C18H19BF3N3O4S |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)(F)F)cc(S(=O)(=O)N[C@@H]2CCCc3c2cnn3CC(=O)OCC)c1 |
| InChI | InChI=1S/C18H19BF3N3O4S/c1-2-29-17(26)10-25-16-5-3-4-15(14(16)9-23-25)24-30(27,28)13-7-11(18(20,21)22)6-12(19)8-13/h6-9,15,24H,2-5,10H2,1H3/t15-/m1/s1 |
| InChIKey | CSQPVQQGYQNISQ-OAHLLOKOSA-N |
| XLogP | 1.61 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|