C23H28F3N3O4SSi — CID 150080243
2-[4-[[3-(trifluoromethyl)-5-(2-trimethylsilylethynyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate (PubChem CID 150080243) has the molecular formula C23H28F3N3O4SSi and a molecular weight of 527.64 g/mol. Its IUPAC name is 2-[4-[[3-(trifluoromethyl)-5-(2-trimethylsilylethynyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate.
| Compound Name | 2-[4-[[3-(trifluoromethyl)-5-(2-trimethylsilylethynyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 150080243 |
| Molecular Formula | C23H28F3N3O4SSi |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[4-[[3-(trifluoromethyl)-5-(2-trimethylsilylethynyl)phenyl]sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1ncc2c1CCCC2NS(=O)(=O)c1cc(C#C[Si](C)(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3N3O4SSi/c1-16(30)33-10-9-29-22-7-5-6-21(20(22)15-27-29)28-34(31,32)19-13-17(8-11-35(2,3)4)12-18(14-19)23(24,25)26/h12-15,21,28H,5-7,9-10H2,1-4H3 |
| InChIKey | DRCQBHNKNQSVHA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|