C17H20N4O6S — CID 150790381
2-[4-[(3-nitrophenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate (PubChem CID 150790381) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[4-[(3-nitrophenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate.
| Compound Name | 2-[4-[(3-nitrophenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 150790381 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[4-[(3-nitrophenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1ncc2c1CCCC2NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N4O6S/c1-12(22)27-9-8-20-17-7-3-6-16(15(17)11-18-20)19-28(25,26)14-5-2-4-13(10-14)21(23)24/h2,4-5,10-11,16,19H,3,6-9H2,1H3 |
| InChIKey | KDSOYRXJVKKJPC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|