C17H21N5O3 — CID 97021089
1-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(3-nitrophenyl)ethyl]urea (PubChem CID 97021089) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(3-nitrophenyl)ethyl]urea.
| Compound Name | 1-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(3-nitrophenyl)ethyl]urea |
|---|---|
| PubChem CID | 97021089 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-3-[(1R)-1-(3-nitrophenyl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)N[C@@H]1CCCc2c1cnn2C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N5O3/c1-11(12-5-3-6-13(9-12)22(24)25)19-17(23)20-15-7-4-8-16-14(15)10-18-21(16)2/h3,5-6,9-11,15H,4,7-8H2,1-2H3,(H2,19,20,23)/t11-,15-/m1/s1 |
| InChIKey | NUIXUCCRGKQZJR-IAQYHMDHSA-N |
| XLogP | 2.77 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|