C24H26N4O5S — CID 174631151
2-[4-[amino-(3-benzoylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate (PubChem CID 174631151) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[4-[amino-(3-benzoylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate.
| Compound Name | 2-[4-[amino-(3-benzoylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 174631151 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[4-[amino-(3-benzoylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1ncc2c1CCCC2N(N)S(=O)(=O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N4O5S/c1-17(29)33-14-13-27-22-11-6-12-23(21(22)16-26-27)28(25)34(31,32)20-10-5-9-19(15-20)24(30)18-7-3-2-4-8-18/h2-5,7-10,15-16,23H,6,11-14,25H2,1H3 |
| InChIKey | JYLXXQONOBVQFP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|