C12H13N3O3 — CID 67578158
methyl 3-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)propanoate (PubChem CID 67578158) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is methyl 3-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)propanoate.
| Compound Name | methyl 3-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)propanoate |
|---|---|
| PubChem CID | 67578158 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | methyl 3-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)propanoate |
| SMILES | COC(=O)CCn1c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C12H13N3O3/c1-18-10(16)7-8-15-11(13-14-12(15)17)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,14,17) |
| InChIKey | DEHYKOFGDWBQRW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |