3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate

C15H21N3O2 — CID 153352780

IUPAC3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate
SMILESCOC(=O)CCN.Cc1n[nH]c(C)c1-c1ccccc1
InChIInChI=1S/C11H12N2.C4H9NO2/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10;1-7-4(6)2-3-5/h3-7H,1-2H3,(H,12,13);2-3,5H2,1H3
InChIKeyKKRIQLVNJULFBR-UHFFFAOYSA-N
MW275.35 g/mol
LogP2.20
Rot. Bonds3

About 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate

3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate (PubChem CID 153352780) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate.

Molecular Properties

Compound Name3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate
PubChem CID153352780
Molecular FormulaC15H21N3O2
Molecular Weight275.35 g/mol
Exact Mass275.16
IUPAC Name3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate
SMILESCOC(=O)CCN.Cc1n[nH]c(C)c1-c1ccccc1
InChIInChI=1S/C11H12N2.C4H9NO2/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10;1-7-4(6)2-3-5/h3-7H,1-2H3,(H,12,13);2-3,5H2,1H3
InChIKeyKKRIQLVNJULFBR-UHFFFAOYSA-N
XLogP2.20
TPSA81.00 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.35
LogP ≤ 52.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate?
The IUPAC name of 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate (CID 153352780) is 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate.
What is the SMILES notation for 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate?
The canonical SMILES for 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate is COC(=O)CCN.Cc1n[nH]c(C)c1-c1ccccc1.
What is the InChIKey of 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate?
The InChIKey is KKRIQLVNJULFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.C4H9NO2/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10;1-7-4(6)2-3-5/h3-7H,1-2H3,(H,12,13);2-3,5H2,1H3.
What are the key properties of 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate?
3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate has a molecular weight of 275.35 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate is sourced from PubChem (CID 153352780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).