C15H21N3O2 — CID 153352780
3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate (PubChem CID 153352780) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate.
| Compound Name | 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate |
|---|---|
| PubChem CID | 153352780 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3,5-dimethyl-4-phenyl-1H-pyrazole;methyl 3-aminopropanoate |
| SMILES | COC(=O)CCN.Cc1n[nH]c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C11H12N2.C4H9NO2/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10;1-7-4(6)2-3-5/h3-7H,1-2H3,(H,12,13);2-3,5H2,1H3 |
| InChIKey | KKRIQLVNJULFBR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |