C24H28N2O2 — CID 68653691
2-[2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]ethyl]-5-phenylpentanoic acid (PubChem CID 68653691) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]ethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]ethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 68653691 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]ethyl]-5-phenylpentanoic acid |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(CCC(CCCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-17-23(18(2)26-25-17)21-14-11-20(12-15-21)13-16-22(24(27)28)10-6-9-19-7-4-3-5-8-19/h3-5,7-8,11-12,14-15,22H,6,9-10,13,16H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | CJHCGPHUNLBVKH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |