C35H39O — CID 143824359
CID 143824359 (PubChem CID 143824359) has the molecular formula C35H39O and a molecular weight of 475.70 g/mol.
| Compound Name | CID 143824359 |
|---|---|
| PubChem CID | 143824359 |
| Molecular Formula | C35H39O |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | — |
| SMILES | CC.Cc1ccc(C2=C(c3ccc(CCC(CCCc4ccccc4)C(=O)C4=CC=C4)cc3)[CH]2)cc1.[H][H] |
| InChI | InChI=1S/C33H31O.C2H6.H2/c1-24-13-18-27(19-14-24)31-23-32(31)28-20-15-26(16-21-28)17-22-30(33(34)29-11-6-12-29)10-5-9-25-7-3-2-4-8-25;1-2;/h2-4,6-8,11-16,18-21,23,30H,5,9-10,17,22H2,1H3;1-2H3;1H |
| InChIKey | QOXXFHBSUVYDSU-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|