C27H29ClO — CID 54348896
1-[4-(4-chlorophenyl)phenyl]-4-methyl-2-(3-phenylpropyl)pentan-1-one (PubChem CID 54348896) has the molecular formula C27H29ClO and a molecular weight of 404.98 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)phenyl]-4-methyl-2-(3-phenylpropyl)pentan-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)phenyl]-4-methyl-2-(3-phenylpropyl)pentan-1-one |
|---|---|
| PubChem CID | 54348896 |
| Molecular Formula | C27H29ClO |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[4-(4-chlorophenyl)phenyl]-4-methyl-2-(3-phenylpropyl)pentan-1-one |
| SMILES | CC(C)CC(CCCc1ccccc1)C(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H29ClO/c1-20(2)19-25(10-6-9-21-7-4-3-5-8-21)27(29)24-13-11-22(12-14-24)23-15-17-26(28)18-16-23/h3-5,7-8,11-18,20,25H,6,9-10,19H2,1-2H3 |
| InChIKey | UEGXHECOENFAPC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |