C13H12N2O6 — CID 115931542
4-(3-methoxy-3-oxopropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid (PubChem CID 115931542) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 4-(3-methoxy-3-oxopropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid.
| Compound Name | 4-(3-methoxy-3-oxopropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115931542 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-(3-methoxy-3-oxopropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
| SMILES | COC(=O)CCn1c(=O)c(=O)[nH]c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C13H12N2O6/c1-21-9(16)5-6-15-10-7(13(19)20)3-2-4-8(10)14-11(17)12(15)18/h2-4H,5-6H2,1H3,(H,14,17)(H,19,20) |
| InChIKey | OSLXIPXVRKHHQA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|