C14H16N2O4 — CID 115931540
4-(2,2-dimethylpropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid (PubChem CID 115931540) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid.
| Compound Name | 4-(2,2-dimethylpropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115931540 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
| SMILES | CC(C)(C)Cn1c(=O)c(=O)[nH]c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C14H16N2O4/c1-14(2,3)7-16-10-8(13(19)20)5-4-6-9(10)15-11(17)12(16)18/h4-6H,7H2,1-3H3,(H,15,17)(H,19,20) |
| InChIKey | RXHXJQNZMPMVEL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|