C14H16N2O5 — CID 115931599
4-(1-ethoxypropan-2-yl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid (PubChem CID 115931599) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-(1-ethoxypropan-2-yl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid.
| Compound Name | 4-(1-ethoxypropan-2-yl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115931599 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(1-ethoxypropan-2-yl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
| SMILES | CCOCC(C)n1c(=O)c(=O)[nH]c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C14H16N2O5/c1-3-21-7-8(2)16-11-9(14(19)20)5-4-6-10(11)15-12(17)13(16)18/h4-6,8H,3,7H2,1-2H3,(H,15,17)(H,19,20) |
| InChIKey | XYVMNPSMAOERBD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|