C15H18N2O4 — CID 115541310
1-(4-methylpentan-2-yl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid (PubChem CID 115541310) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(4-methylpentan-2-yl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid.
| Compound Name | 1-(4-methylpentan-2-yl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115541310 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(4-methylpentan-2-yl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid |
| SMILES | CC(C)CC(C)n1c(=O)c(=O)[nH]c2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C15H18N2O4/c1-8(2)7-9(3)17-11-6-4-5-10(15(20)21)12(11)16-13(18)14(17)19/h4-6,8-9H,7H2,1-3H3,(H,16,18)(H,20,21) |
| InChIKey | YBWRQTSKLWHDNR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|