C15H16N2O4 — CID 115541531
1-(1-methylcyclopentyl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid (PubChem CID 115541531) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-(1-methylcyclopentyl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid.
| Compound Name | 1-(1-methylcyclopentyl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115541531 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(1-methylcyclopentyl)-2,3-dioxo-4H-quinoxaline-5-carboxylic acid |
| SMILES | CC1(n2c(=O)c(=O)[nH]c3c(C(=O)O)cccc32)CCCC1 |
| InChI | InChI=1S/C15H16N2O4/c1-15(7-2-3-8-15)17-10-6-4-5-9(14(20)21)11(10)16-12(18)13(17)19/h4-6H,2-3,7-8H2,1H3,(H,16,18)(H,20,21) |
| InChIKey | NJKIIXHQXNKVOA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|