C13H11N3O5 — CID 106189481
2,3-dioxo-1-(5-oxopyrrolidin-3-yl)-4H-quinoxaline-5-carboxylic acid (PubChem CID 106189481) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2,3-dioxo-1-(5-oxopyrrolidin-3-yl)-4H-quinoxaline-5-carboxylic acid.
| Compound Name | 2,3-dioxo-1-(5-oxopyrrolidin-3-yl)-4H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 106189481 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,3-dioxo-1-(5-oxopyrrolidin-3-yl)-4H-quinoxaline-5-carboxylic acid |
| SMILES | O=C1CC(n2c(=O)c(=O)[nH]c3c(C(=O)O)cccc32)CN1 |
| InChI | InChI=1S/C13H11N3O5/c17-9-4-6(5-14-9)16-8-3-1-2-7(13(20)21)10(8)15-11(18)12(16)19/h1-3,6H,4-5H2,(H,14,17)(H,15,18)(H,20,21) |
| InChIKey | BMGYBABDVYFODG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|