C14H14N2O4 — CID 115931509
4-(1-cyclopropylethyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid (PubChem CID 115931509) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-(1-cyclopropylethyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid.
| Compound Name | 4-(1-cyclopropylethyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115931509 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(1-cyclopropylethyl)-2,3-dioxo-1H-quinoxaline-5-carboxylic acid |
| SMILES | CC(C1CC1)n1c(=O)c(=O)[nH]c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C14H14N2O4/c1-7(8-5-6-8)16-11-9(14(19)20)3-2-4-10(11)15-12(17)13(16)18/h2-4,7-8H,5-6H2,1H3,(H,15,17)(H,19,20) |
| InChIKey | DAKMBBUBDTVLNX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|