C14H24F3N3O — CID 61491806
N-[[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 61491806) has the molecular formula C14H24F3N3O and a molecular weight of 307.36 g/mol. Its IUPAC name is N-[[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61491806 |
| Molecular Formula | C14H24F3N3O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c(C)nn(CCCOCC(F)(F)F)c1C |
| InChI | InChI=1S/C14H24F3N3O/c1-4-6-18-9-13-11(2)19-20(12(13)3)7-5-8-21-10-14(15,16)17/h18H,4-10H2,1-3H3 |
| InChIKey | KVWHBHAVYNBFKY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|