C13H25N3O — CID 110905500
2-[3,5-dimethyl-4-[(pentylamino)methyl]pyrazol-1-yl]ethanol (PubChem CID 110905500) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[(pentylamino)methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3,5-dimethyl-4-[(pentylamino)methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110905500 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-[3,5-dimethyl-4-[(pentylamino)methyl]pyrazol-1-yl]ethanol |
| SMILES | CCCCCNCc1c(C)nn(CCO)c1C |
| InChI | InChI=1S/C13H25N3O/c1-4-5-6-7-14-10-13-11(2)15-16(8-9-17)12(13)3/h14,17H,4-10H2,1-3H3 |
| InChIKey | DBUTVUQYFSFMGL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|