C14H23N5O — CID 110905622
2-[3,5-dimethyl-4-[(3-pyrazol-1-ylpropylamino)methyl]pyrazol-1-yl]ethanol (PubChem CID 110905622) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[(3-pyrazol-1-ylpropylamino)methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3,5-dimethyl-4-[(3-pyrazol-1-ylpropylamino)methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110905622 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-[3,5-dimethyl-4-[(3-pyrazol-1-ylpropylamino)methyl]pyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)c(C)c1CNCCCn1cccn1 |
| InChI | InChI=1S/C14H23N5O/c1-12-14(13(2)19(17-12)9-10-20)11-15-5-3-7-18-8-4-6-16-18/h4,6,8,15,20H,3,5,7,9-11H2,1-2H3 |
| InChIKey | LTVMLVPJRRYYCO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|