C19H26N4O — CID 111467749
2-[3,5-dimethyl-4-[[2-(7-methyl-1H-indol-3-yl)ethylamino]methyl]pyrazol-1-yl]ethanol (PubChem CID 111467749) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[[2-(7-methyl-1H-indol-3-yl)ethylamino]methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3,5-dimethyl-4-[[2-(7-methyl-1H-indol-3-yl)ethylamino]methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 111467749 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-[3,5-dimethyl-4-[[2-(7-methyl-1H-indol-3-yl)ethylamino]methyl]pyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)c(C)c1CNCCc1c[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C19H26N4O/c1-13-5-4-6-17-16(11-21-19(13)17)7-8-20-12-18-14(2)22-23(9-10-24)15(18)3/h4-6,11,20-21,24H,7-10,12H2,1-3H3 |
| InChIKey | GROQHDFBGIVLOO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|