C13H14Cl3N3 — CID 112686473
3-pyrazol-1-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-1-amine (PubChem CID 112686473) has the molecular formula C13H14Cl3N3 and a molecular weight of 318.63 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-1-amine.
| Compound Name | 3-pyrazol-1-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 112686473 |
| Molecular Formula | C13H14Cl3N3 |
| Molecular Weight | 318.63 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-pyrazol-1-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-1-amine |
| SMILES | Clc1ccc(Cl)c(CNCCCn2cccn2)c1Cl |
| InChI | InChI=1S/C13H14Cl3N3/c14-11-3-4-12(15)13(16)10(11)9-17-5-1-7-19-8-2-6-18-19/h2-4,6,8,17H,1,5,7,9H2 |
| InChIKey | OZQLKRBSNUFHAZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|