C14H16ClN5 — CID 115625574
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine (PubChem CID 115625574) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115625574 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrazol-1-ylpropan-1-amine |
| SMILES | Clc1ccc2nc(CNCCCn3cccn3)cn2c1 |
| InChI | InChI=1S/C14H16ClN5/c15-12-3-4-14-18-13(11-19(14)10-12)9-16-5-1-7-20-8-2-6-17-20/h2-4,6,8,10-11,16H,1,5,7,9H2 |
| InChIKey | YOHIPFIZRWSWFZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|