C13H15ClF3N3 — CID 115491273
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115491273) has the molecular formula C13H15ClF3N3 and a molecular weight of 305.73 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115491273 |
| Molecular Formula | C13H15ClF3N3 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | FC(F)(F)CCCCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C13H15ClF3N3/c14-10-3-4-12-19-11(9-20(12)8-10)7-18-6-2-1-5-13(15,16)17/h3-4,8-9,18H,1-2,5-7H2 |
| InChIKey | VWXAYSZFSMQGBV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|